Molecule: L-glutamic 5-semialdehyde zwitterion

Zwitterionic form of homocysteine arising from transfer of a proton from the carboxy to the amino group; major species at pH 7.3.
Synonyms for L-glutamic 5-semialdehyde zwitterion :
(2S)-2-ammonio-5-oxopentanoate
L-glutamate 5-semialdehyde
Molecular Formula: C5H9NO3
Molecular wt: 131.12990 g/mole
Charge: 0
SMILES: [H]C(=O)CC[C@H]([NH3+])C([O-])=O
InChIKey: KABXUUFDPUOJMW-BYPYZUCNSA-N
InChI=1S/C5H9NO3/c6-4(5(8)9)2-1-3-7/h3-4H,1-2,6H2,(H,8,9)/t4-/m0/s1
CHEBI:58066
Sample reactions for this molecule:
glutamate + ATP + NADPH + H+ => L-glutamate gamma-semialdehyde + NADP+ + ADP + orthophosphate [P5CS]
ornithine + alpha-ketoglutarate <=> glutamate + L-glutamate gamma-semialdehyde [OAT]
L-glutamate gamma-semialdehyde <=> L-1-pyrroline-5-carboxylate
glutamate + L-glutamate gamma-semialdehyde <=> ornithine + alpha-ketoglutarate [OAT]
1PYR-5COOH spontaneously hydrolyses to L-GluSS
ALDH4A1 oxidises L-GluSS to Glu