Molecule: (6S)-5,6,7,8-tetrahydrofolate(2-)

Dianion of (6S)-5,6,7,8-tetrahydrofolic acid arising from deprotonation of both carboxylic acid functions.
Synonyms for (6S)-5,6,7,8-tetrahydrofolate(2-) :
(6S)-5,6,7,8-tetrahydrofolate
(6S)-5,6,7,8-tetrahydrofolate dianion
Molecular Formula: C19H21N7O6
Molecular wt: 443.41330 g/mole
Charge: -2
SMILES: Nc1nc2NC[C@H](CNc3ccc(cc3)C(=O)N[C@@H](CCC([O-])=O)C([O-])=O)Nc2c(=O)[nH]1
InChIKey: MSTNYGQPCMXVAQ-RYUDHWBXSA-L
InChI=1S/C19H23N7O6/c20-19-25-15-14(17(30)26-19)23-11(8-22-15)7-21-10-3-1-9(2-4-10)16(29)24-12(18(31)32)5-6-13(27)28/h1-4,11-12,21,23H,5-8H2,(H,24,29)(H,27,28)(H,31,32)(H4,20,22,25,26,30)/p-2/t11-,12-/m0/s1
CHEBI:57453
Sample reactions for this molecule:
FPGS-2 transforms THF to THFPG
DHF is reduced to tetrahydrofolate (THF)
SLC25A32 transports THF from cytosol to mitochondrial matrix
SLC25A32 transports THF from mitochondrial matrix to cytosol
MTR transfers CH3 group from 5-methyl-THF to cob(I)alamin
N-formiminoglutamate + tetrahydrofolate => glutamate + 5-formiminotetrahydrofolate
dUMP + N5,N10-methylene tetrahydrofolate => TMP + dihydrofolate
AICAR + 10-Formyl-THF => FAICAR + THF
GAR + 10-Formyl-THF => FGAR + THF