Molecule: ganglioside GT1b

A sialoheptaosylceramide where the sialoheptaosyl portion contains three sialic acid residues.
Synonyms for ganglioside GT1b :
GT1b ganglioside (C36)
Molecular Formula: C95H165N5O47
Molecular wt: 2129.33190 g/mole
Charge: 0
SMILES: [H][C@]1(O[C@@](C[C@H](O)[C@H]1NC(C)=O)(O[C@H](CO)[C@@H](O)[C@]1([H])O[C@@](C[C@H](O)[C@H]1NC(C)=O)(O[C@@H]1[C@@H](O)[C@@H](O[C@H](CO)[C@@H]1O[C@@H]1O[C@H](CO)[C@H](O)[C@H](O[C@@H]2O[C@H](CO)[C@H](O)[C@H](O[C@@]3(C[C@H](O)[C@@H](NC(C)=O)[C@@]([H])(O3)[C@H](O)[C@H](O)CO)C(O)=O)[C@H]2O)[C@H]1NC(C)=O)O[C@@H]1[C@@H](CO)O[C@@H](OC[C@H](NC(=O)CCCCCCCCCCCCCCCCC)[C@H](O)\C=C\CCCCCCCCCCCCC)[C@H](O)[C@H]1O)C(O)=O)C(O)=O)[C@H](O)[C@H](O)CO
InChIKey: LEZNRPFLOGYEIO-QSEDPUOVSA-N
InChI=1S/C95H165N5O47/c1-7-9-11-13-15-17-19-21-22-24-26-28-30-32-34-36-64(118)100-52(53(112)35-33-31-29-27-25-23-20-18-16-14-12-10-8-2)47-134-87-75(125)74(124)78(62(45-106)137-87)139-89-77(127)85(147-95(92(132)133)39-56(115)67(98-50(5)110)83(145-95)73(123)61(44-105)142-93(90(128)129)37-54(113)65(96-48(3)108)81(143-93)69(119)57(116)40-101)79(63(46-107)138-89)140-86-68(99-51(6)111)80(71(121)59(42-103)135-86)141-88-76(126)84(72(122)60(43-104)136-88)146-94(91(130)131)38-55(114)66(97-49(4)109)82(144-94)70(120)58(117)41-102/h33,35,52-63,65-89,101-107,112-117,119-127H,7-32,34,36-47H2,1-6H3,(H,96,108)(H,97,109)(H,98,110)(H,99,111)(H,100,118)(H,128,129)(H,130,131)(H,132,133)/b35-33+/t52-,53+,54-,55-,56-,57+,58+,59+,60+,61+,62+,63+,65+,66+,67+,68+,69+,70+,71-,72-,73+,74+,75+,76+,77+,78+,79-,80+,81+,82+,83+,84-,85+,86-,87+,88-,89-,93+,94-,95-/m0/s1
CHEBI:60913
Sample reactions for this molecule:
botB HC:LC binds SYT1 or 2 and GT1b on the target cell surface
botB HC transports botB LC from target cell synaptic vesicle membrane into cytosol
botA HC:LC binds SV2A, B, or C and GT1b on the target cell surface
botA HC transports botA LC from target cell synaptic vesicle membrane into cytosol
botE HC:LC binds SV2A or B and GT1b on the target cell surface
botE HC transports botE LC from target cell synaptic vesicle membrane into cytosol
botC HC:LC binds GT1b on the target cell surface
botC HC transports botC LC from target cell synaptic vesicle membrane to cytosol
botF HC:LC binds SV2A or B or C and GT1b on the target cell surface
botF HC transports botF LC from target cell synaptic vesicle membrane into cytosol